C18H11Cl2F3N2OS — CID 46033809
4-(2-chlorophenoxy)-2-[(3-chlorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine (PubChem CID 46033809) has the molecular formula C18H11Cl2F3N2OS and a molecular weight of 431.27 g/mol. Its IUPAC name is 4-(2-chlorophenoxy)-2-[(3-chlorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-(2-chlorophenoxy)-2-[(3-chlorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 46033809 |
| Molecular Formula | C18H11Cl2F3N2OS |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | 4-(2-chlorophenoxy)-2-[(3-chlorophenyl)methylsulfanyl]-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(Oc2ccccc2Cl)nc(SCc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C18H11Cl2F3N2OS/c19-12-5-3-4-11(8-12)10-27-17-24-15(18(21,22)23)9-16(25-17)26-14-7-2-1-6-13(14)20/h1-9H,10H2 |
| InChIKey | ZGHOVFUXAWHPSL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |