C18H14ClN3O5 — CID 126393979
(5E)-5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione (PubChem CID 126393979) has the molecular formula C18H14ClN3O5 and a molecular weight of 387.78 g/mol. Its IUPAC name is (5E)-5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126393979 |
| Molecular Formula | C18H14ClN3O5 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (5E)-5-[(3-chloro-4,5-dimethoxyphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccncc3)C2=O)cc(Cl)c1OC |
| InChI | InChI=1S/C18H14ClN3O5/c1-26-14-9-10(8-13(19)15(14)27-2)7-12-16(23)21-18(25)22(17(12)24)11-3-5-20-6-4-11/h3-9H,1-2H3,(H,21,23,25)/b12-7+ |
| InChIKey | BAAJFMSCGYYAJX-KPKJPENVSA-N |
| XLogP | 2.42 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|