C16H10ClN3O4 — CID 126394073
(5E)-5-[(3-chloro-4-hydroxyphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione (PubChem CID 126394073) has the molecular formula C16H10ClN3O4 and a molecular weight of 343.73 g/mol. Its IUPAC name is (5E)-5-[(3-chloro-4-hydroxyphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(3-chloro-4-hydroxyphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126394073 |
| Molecular Formula | C16H10ClN3O4 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | (5E)-5-[(3-chloro-4-hydroxyphenyl)methylidene]-1-pyridin-4-yl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccncc2)C(=O)/C1=C/c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C16H10ClN3O4/c17-12-8-9(1-2-13(12)21)7-11-14(22)19-16(24)20(15(11)23)10-3-5-18-6-4-10/h1-8,21H,(H,19,22,24)/b11-7+ |
| InChIKey | BVCNNAVFQTZJIN-YRNVUSSQSA-N |
| XLogP | 2.11 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|