C18H15N3O3 — CID 782506
1-(3,5-dimethylphenyl)-5-(pyridin-4-ylmethylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 782506) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-5-(pyridin-4-ylmethylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(3,5-dimethylphenyl)-5-(pyridin-4-ylmethylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 782506 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-5-(pyridin-4-ylmethylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cc(C)cc(N2C(=O)NC(=O)C(=Cc3ccncc3)C2=O)c1 |
| InChI | InChI=1S/C18H15N3O3/c1-11-7-12(2)9-14(8-11)21-17(23)15(16(22)20-18(21)24)10-13-3-5-19-6-4-13/h3-10H,1-2H3,(H,20,22,24) |
| InChIKey | PHQKFJKNRNPQHP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|