C20H18N2O3 — CID 7326330
(5E)-1-(3,5-dimethylphenyl)-5-[(4-methylphenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 7326330) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is (5E)-1-(3,5-dimethylphenyl)-5-[(4-methylphenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(3,5-dimethylphenyl)-5-[(4-methylphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7326330 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (5E)-1-(3,5-dimethylphenyl)-5-[(4-methylphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(/C=C2\C(=O)NC(=O)N(c3cc(C)cc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C20H18N2O3/c1-12-4-6-15(7-5-12)11-17-18(23)21-20(25)22(19(17)24)16-9-13(2)8-14(3)10-16/h4-11H,1-3H3,(H,21,23,25)/b17-11+ |
| InChIKey | XJJMXLNHAVZAIZ-GZTJUZNOSA-N |
| XLogP | 3.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|