C19H21ClN2O5S — CID 126396862
2-[2-chloro-4-(2,3-dihydroindol-1-ylsulfonyl)phenoxy]-N-(3-hydroxypropyl)acetamide (PubChem CID 126396862) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-[2-chloro-4-(2,3-dihydroindol-1-ylsulfonyl)phenoxy]-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-[2-chloro-4-(2,3-dihydroindol-1-ylsulfonyl)phenoxy]-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 126396862 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-[2-chloro-4-(2,3-dihydroindol-1-ylsulfonyl)phenoxy]-N-(3-hydroxypropyl)acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1Cl)NCCCO |
| InChI | InChI=1S/C19H21ClN2O5S/c20-16-12-15(6-7-18(16)27-13-19(24)21-9-3-11-23)28(25,26)22-10-8-14-4-1-2-5-17(14)22/h1-2,4-7,12,23H,3,8-11,13H2,(H,21,24) |
| InChIKey | RGPWWCVTCNGQAG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|