C34H27BrClN3O6 — CID 126399696
[4-bromo-2-[[[3-(2-chlorophenyl)-7-ethyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126399696) has the molecular formula C34H27BrClN3O6 and a molecular weight of 688.96 g/mol. Its IUPAC name is [4-bromo-2-[[[3-(2-chlorophenyl)-7-ethyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [4-bromo-2-[[[3-(2-chlorophenyl)-7-ethyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126399696 |
| Molecular Formula | C34H27BrClN3O6 |
| Molecular Weight | 688.96 g/mol |
| Exact Mass | 687.08 |
| IUPAC Name | [4-bromo-2-[[[3-(2-chlorophenyl)-7-ethyl-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | CCc1cccc2c(-c3ccccc3Cl)c(C(=O)NN=Cc3cc(Br)ccc3OC(=O)c3ccc(OC(C)=O)c(OC)c3)[nH]c12 |
| InChI | InChI=1S/C34H27BrClN3O6/c1-4-20-8-7-10-25-30(24-9-5-6-11-26(24)36)32(38-31(20)25)33(41)39-37-18-22-16-23(35)13-15-27(22)45-34(42)21-12-14-28(44-19(2)40)29(17-21)43-3/h5-18,38H,4H2,1-3H3,(H,39,41) |
| InChIKey | KLGACNCFTKFVIL-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.96 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|