C28H15Br2ClF3N3O4 — CID 126401208
[2,4-dibromo-6-[[[3-(2-chlorophenyl)-7-(trifluoromethyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126401208) has the molecular formula C28H15Br2ClF3N3O4 and a molecular weight of 709.70 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[3-(2-chlorophenyl)-7-(trifluoromethyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-7-(trifluoromethyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126401208 |
| Molecular Formula | C28H15Br2ClF3N3O4 |
| Molecular Weight | 709.70 g/mol |
| Exact Mass | 706.91 |
| IUPAC Name | [2,4-dibromo-6-[[[3-(2-chlorophenyl)-7-(trifluoromethyl)-1H-indole-2-carbonyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1C=NNC(=O)c1[nH]c2c(C(F)(F)F)cccc2c1-c1ccccc1Cl)c1ccco1 |
| InChI | InChI=1S/C28H15Br2ClF3N3O4/c29-15-11-14(25(19(30)12-15)41-27(39)21-9-4-10-40-21)13-35-37-26(38)24-22(16-5-1-2-8-20(16)31)17-6-3-7-18(23(17)36-24)28(32,33)34/h1-13,36H,(H,37,38) |
| InChIKey | ZWQIUMCGHQATFX-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.70 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|