C27H15Br3ClN3O4 — CID 126400633
[2,4-dibromo-6-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 126400633) has the molecular formula C27H15Br3ClN3O4 and a molecular weight of 720.60 g/mol. Its IUPAC name is [2,4-dibromo-6-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2,4-dibromo-6-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126400633 |
| Molecular Formula | C27H15Br3ClN3O4 |
| Molecular Weight | 720.60 g/mol |
| Exact Mass | 716.83 |
| IUPAC Name | [2,4-dibromo-6-[[(5-bromo-7-chloro-3-phenyl-1H-indole-2-carbonyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1c(Br)cc(Br)cc1C=NNC(=O)c1[nH]c2c(Cl)cc(Br)cc2c1-c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C27H15Br3ClN3O4/c28-16-9-15(25(19(30)11-16)38-27(36)21-7-4-8-37-21)13-32-34-26(35)24-22(14-5-2-1-3-6-14)18-10-17(29)12-20(31)23(18)33-24/h1-13,33H,(H,34,35) |
| InChIKey | WIWGZYZNJWFAAE-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.60 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|