C32H36N2O5S — CID 126412365
N-[4-(2-adamantyl)phenyl]-4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]benzamide (PubChem CID 126412365) has the molecular formula C32H36N2O5S and a molecular weight of 560.72 g/mol. Its IUPAC name is N-[4-(2-adamantyl)phenyl]-4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]benzamide.
| Compound Name | N-[4-(2-adamantyl)phenyl]-4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]benzamide |
|---|---|
| PubChem CID | 126412365 |
| Molecular Formula | C32H36N2O5S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | N-[4-(2-adamantyl)phenyl]-4-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)Nc3ccc(C4C5CC6CC(C5)CC4C6)cc3)cc2)cc1OC |
| InChI | InChI=1S/C32H36N2O5S/c1-34(40(36,37)28-12-13-29(38-2)30(19-28)39-3)27-10-6-23(7-11-27)32(35)33-26-8-4-22(5-9-26)31-24-15-20-14-21(17-24)18-25(31)16-20/h4-13,19-21,24-25,31H,14-18H2,1-3H3,(H,33,35) |
| InChIKey | BIBFYKITPBFBFF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |