C31H34N2O4S — CID 126414664
N-[4-(2-adamantyl)phenyl]-4-[(4-methoxyphenyl)sulfonyl-methylamino]benzamide (PubChem CID 126414664) has the molecular formula C31H34N2O4S and a molecular weight of 530.69 g/mol. Its IUPAC name is N-[4-(2-adamantyl)phenyl]-4-[(4-methoxyphenyl)sulfonyl-methylamino]benzamide.
| Compound Name | N-[4-(2-adamantyl)phenyl]-4-[(4-methoxyphenyl)sulfonyl-methylamino]benzamide |
|---|---|
| PubChem CID | 126414664 |
| Molecular Formula | C31H34N2O4S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | N-[4-(2-adamantyl)phenyl]-4-[(4-methoxyphenyl)sulfonyl-methylamino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)Nc3ccc(C4C5CC6CC(C5)CC4C6)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H34N2O4S/c1-33(38(35,36)29-13-11-28(37-2)12-14-29)27-9-5-23(6-10-27)31(34)32-26-7-3-22(4-8-26)30-24-16-20-15-21(18-24)19-25(30)17-20/h3-14,20-21,24-25,30H,15-19H2,1-2H3,(H,32,34) |
| InChIKey | VFYRYGHDBKRGTO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |