C27H24N2O8 — CID 126414999
[4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126414999) has the molecular formula C27H24N2O8 and a molecular weight of 504.50 g/mol. Its IUPAC name is [4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126414999 |
| Molecular Formula | C27H24N2O8 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | [4-[(Z)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(/C=C2/C(=O)NN(c3ccccc3)C2=O)ccc1OC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C27H24N2O8/c1-33-21-13-16(12-19-25(30)28-29(26(19)31)18-8-6-5-7-9-18)10-11-20(21)37-27(32)17-14-22(34-2)24(36-4)23(15-17)35-3/h5-15H,1-4H3,(H,28,30)/b19-12- |
| InChIKey | ZHPSIYJUZHESHR-UNOMPAQXSA-N |
| XLogP | 3.40 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|