C22H20N2O7 — CID 134612750
ethyl 4-[(4Z)-4-[(4-acetyloxy-3-methoxyphenyl)methylidene]-3,5-dioxopyrazolidin-1-yl]benzoate (PubChem CID 134612750) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is ethyl 4-[(4Z)-4-[(4-acetyloxy-3-methoxyphenyl)methylidene]-3,5-dioxopyrazolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(4Z)-4-[(4-acetyloxy-3-methoxyphenyl)methylidene]-3,5-dioxopyrazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 134612750 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | ethyl 4-[(4Z)-4-[(4-acetyloxy-3-methoxyphenyl)methylidene]-3,5-dioxopyrazolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2NC(=O)/C(=C/c3ccc(OC(C)=O)c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H20N2O7/c1-4-30-22(28)15-6-8-16(9-7-15)24-21(27)17(20(26)23-24)11-14-5-10-18(31-13(2)25)19(12-14)29-3/h5-12H,4H2,1-3H3,(H,23,26)/b17-11- |
| InChIKey | WNUPKCBSRQHGQB-BOPFTXTBSA-N |
| XLogP | 2.26 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|