C21H23N3O4 — CID 126415850
butyl 4-[[2-(3-cyano-4,6-dimethyl-2-oxo-1-pyridinyl)acetyl]amino]benzoate (PubChem CID 126415850) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is butyl 4-[[2-(3-cyano-4,6-dimethyl-2-oxo-1-pyridinyl)acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(3-cyano-4,6-dimethyl-2-oxo-1-pyridinyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126415850 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | butyl 4-[[2-(3-cyano-4,6-dimethyl-2-oxo-1-pyridinyl)acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)Cn2c(C)cc(C)c(C#N)c2=O)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-4-5-10-28-21(27)16-6-8-17(9-7-16)23-19(25)13-24-15(3)11-14(2)18(12-22)20(24)26/h6-9,11H,4-5,10,13H2,1-3H3,(H,23,25) |
| InChIKey | IAWHVDCZVBNXOT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|