C19H23N3O2 — CID 126423150
1-[(S)-(4-methoxyphenyl)-pyridin-4-ylmethyl]-3-(1-methylcyclobutyl)urea (PubChem CID 126423150) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-[(S)-(4-methoxyphenyl)-pyridin-4-ylmethyl]-3-(1-methylcyclobutyl)urea.
| Compound Name | 1-[(S)-(4-methoxyphenyl)-pyridin-4-ylmethyl]-3-(1-methylcyclobutyl)urea |
|---|---|
| PubChem CID | 126423150 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-[(S)-(4-methoxyphenyl)-pyridin-4-ylmethyl]-3-(1-methylcyclobutyl)urea |
| SMILES | COc1ccc([C@H](NC(=O)NC2(C)CCC2)c2ccncc2)cc1 |
| InChI | InChI=1S/C19H23N3O2/c1-19(10-3-11-19)22-18(23)21-17(15-8-12-20-13-9-15)14-4-6-16(24-2)7-5-14/h4-9,12-13,17H,3,10-11H2,1-2H3,(H2,21,22,23)/t17-/m0/s1 |
| InChIKey | VRWLDIKVVYBBDU-KRWDZBQOSA-N |
| XLogP | 3.42 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |