C16H17N5O2S2 — CID 126424571
1-(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)-3-[(1R)-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea (PubChem CID 126424571) has the molecular formula C16H17N5O2S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 1-(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)-3-[(1R)-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea.
| Compound Name | 1-(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)-3-[(1R)-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 126424571 |
| Molecular Formula | C16H17N5O2S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1-(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)-3-[(1R)-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea |
| SMILES | C[C@@H](NC(=O)Nc1cnc2sccn2c1=O)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C16H17N5O2S2/c1-9(13-19-10-4-2-3-5-12(10)25-13)18-15(23)20-11-8-17-16-21(14(11)22)6-7-24-16/h6-9H,2-5H2,1H3,(H2,18,20,23)/t9-/m1/s1 |
| InChIKey | SPOQUPYPLMZKSW-SECBINFHSA-N |
| XLogP | 2.97 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |