C17H20N6OS — CID 97444890
1-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[(1R)-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea (PubChem CID 97444890) has the molecular formula C17H20N6OS and a molecular weight of 356.46 g/mol. Its IUPAC name is 1-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[(1R)-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea.
| Compound Name | 1-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[(1R)-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 97444890 |
| Molecular Formula | C17H20N6OS |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[(1R)-1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]urea |
| SMILES | Cc1nc2c(NC(=O)N[C@H](C)c3nc4c(s3)CCCC4)cccn2n1 |
| InChI | InChI=1S/C17H20N6OS/c1-10(16-20-12-6-3-4-8-14(12)25-16)18-17(24)21-13-7-5-9-23-15(13)19-11(2)22-23/h5,7,9-10H,3-4,6,8H2,1-2H3,(H2,18,21,24)/t10-/m1/s1 |
| InChIKey | KLAMABGZQRAACU-SNVBAGLBSA-N |
| XLogP | 3.26 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |