C17H17FN2O3S — CID 126425276
N-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluoro-2-pyridinyl)-N-methylbenzamide (PubChem CID 126425276) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluoro-2-pyridinyl)-N-methylbenzamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluoro-2-pyridinyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 126425276 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluoro-2-pyridinyl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(-c2ncccc2F)c1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H17FN2O3S/c1-20(14-7-9-24(22,23)11-14)17(21)13-5-2-4-12(10-13)16-15(18)6-3-8-19-16/h2-6,8,10,14H,7,9,11H2,1H3/t14-/m1/s1 |
| InChIKey | KICUNOBQEBXHCX-CQSZACIVSA-N |
| XLogP | 2.15 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |