C19H25N3O2S — CID 126426003
4-(pyridin-3-ylmethoxy)-N-[(2S)-1-thiophen-3-ylpropan-2-yl]piperidine-1-carboxamide (PubChem CID 126426003) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-(pyridin-3-ylmethoxy)-N-[(2S)-1-thiophen-3-ylpropan-2-yl]piperidine-1-carboxamide.
| Compound Name | 4-(pyridin-3-ylmethoxy)-N-[(2S)-1-thiophen-3-ylpropan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126426003 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-(pyridin-3-ylmethoxy)-N-[(2S)-1-thiophen-3-ylpropan-2-yl]piperidine-1-carboxamide |
| SMILES | C[C@@H](Cc1ccsc1)NC(=O)N1CCC(OCc2cccnc2)CC1 |
| InChI | InChI=1S/C19H25N3O2S/c1-15(11-16-6-10-25-14-16)21-19(23)22-8-4-18(5-9-22)24-13-17-3-2-7-20-12-17/h2-3,6-7,10,12,14-15,18H,4-5,8-9,11,13H2,1H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | PWBUPQNQIKTRRP-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |