C18H24N4O — CID 126426695
N-[(2-methylphenyl)methyl]-2-[3-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide (PubChem CID 126426695) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-2-[3-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide.
| Compound Name | N-[(2-methylphenyl)methyl]-2-[3-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 126426695 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-2-[3-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide |
| SMILES | Cc1ccccc1CNC(=O)Cn1ccc([C@H]2CCCNC2)n1 |
| InChI | InChI=1S/C18H24N4O/c1-14-5-2-3-6-15(14)12-20-18(23)13-22-10-8-17(21-22)16-7-4-9-19-11-16/h2-3,5-6,8,10,16,19H,4,7,9,11-13H2,1H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | BMGXWUMOWWGXHI-INIZCTEOSA-N |
| XLogP | 1.97 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |