C19H26N4OS — CID 126424954
N-(3-phenylsulfanylpropyl)-2-[3-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide (PubChem CID 126424954) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is N-(3-phenylsulfanylpropyl)-2-[3-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide.
| Compound Name | N-(3-phenylsulfanylpropyl)-2-[3-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 126424954 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-(3-phenylsulfanylpropyl)-2-[3-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc([C@H]2CCCNC2)n1)NCCCSc1ccccc1 |
| InChI | InChI=1S/C19H26N4OS/c24-19(21-11-5-13-25-17-7-2-1-3-8-17)15-23-12-9-18(22-23)16-6-4-10-20-14-16/h1-3,7-9,12,16,20H,4-6,10-11,13-15H2,(H,21,24)/t16-/m0/s1 |
| InChIKey | ZQSGRTAVXFPWQH-INIZCTEOSA-N |
| XLogP | 2.65 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|