C15H23N7O — CID 126444957
2-[3-[(3R)-piperidin-3-yl]pyrazol-1-yl]-N-[3-(triazol-1-yl)propyl]acetamide (PubChem CID 126444957) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is 2-[3-[(3R)-piperidin-3-yl]pyrazol-1-yl]-N-[3-(triazol-1-yl)propyl]acetamide.
| Compound Name | 2-[3-[(3R)-piperidin-3-yl]pyrazol-1-yl]-N-[3-(triazol-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 126444957 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 2-[3-[(3R)-piperidin-3-yl]pyrazol-1-yl]-N-[3-(triazol-1-yl)propyl]acetamide |
| SMILES | O=C(Cn1ccc([C@@H]2CCCNC2)n1)NCCCn1ccnn1 |
| InChI | InChI=1S/C15H23N7O/c23-15(17-6-2-8-21-10-7-18-20-21)12-22-9-4-14(19-22)13-3-1-5-16-11-13/h4,7,9-10,13,16H,1-3,5-6,8,11-12H2,(H,17,23)/t13-/m1/s1 |
| InChIKey | OXFGGWVFOLDGFL-CYBMUJFWSA-N |
| XLogP | 0.15 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|