C20H25ClN4O — CID 126427446
4-(5-chloro-2-methylphenyl)-N-[(2S)-1-pyridin-2-ylpropan-2-yl]piperazine-1-carboxamide (PubChem CID 126427446) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-[(2S)-1-pyridin-2-ylpropan-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-[(2S)-1-pyridin-2-ylpropan-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 126427446 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-[(2S)-1-pyridin-2-ylpropan-2-yl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=O)N[C@@H](C)Cc2ccccn2)CC1 |
| InChI | InChI=1S/C20H25ClN4O/c1-15-6-7-17(21)14-19(15)24-9-11-25(12-10-24)20(26)23-16(2)13-18-5-3-4-8-22-18/h3-8,14,16H,9-13H2,1-2H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | LAYZPNGRWVPNAJ-INIZCTEOSA-N |
| XLogP | 3.51 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |