C22H27N3O3 — CID 126428549
(3R)-3-butyl-4-[4-(5-methoxy-3-pyridinyl)benzoyl]-1-methylpiperazin-2-one (PubChem CID 126428549) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (3R)-3-butyl-4-[4-(5-methoxy-3-pyridinyl)benzoyl]-1-methylpiperazin-2-one.
| Compound Name | (3R)-3-butyl-4-[4-(5-methoxy-3-pyridinyl)benzoyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 126428549 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (3R)-3-butyl-4-[4-(5-methoxy-3-pyridinyl)benzoyl]-1-methylpiperazin-2-one |
| SMILES | CCCC[C@@H]1C(=O)N(C)CCN1C(=O)c1ccc(-c2cncc(OC)c2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-4-5-6-20-22(27)24(2)11-12-25(20)21(26)17-9-7-16(8-10-17)18-13-19(28-3)15-23-14-18/h7-10,13-15,20H,4-6,11-12H2,1-3H3/t20-/m1/s1 |
| InChIKey | BICCCSFVYWYGIA-HXUWFJFHSA-N |
| XLogP | 3.23 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |