C12H10F14O4S — CID 12642882
methyl 4,5,5,5-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-3,3-dimethoxy-4-(trifluoromethyl)pentanoate (PubChem CID 12642882) has the molecular formula C12H10F14O4S and a molecular weight of 516.25 g/mol. Its IUPAC name is methyl 4,5,5,5-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-3,3-dimethoxy-4-(trifluoromethyl)pentanoate.
| Compound Name | methyl 4,5,5,5-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-3,3-dimethoxy-4-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 12642882 |
| Molecular Formula | C12H10F14O4S |
| Molecular Weight | 516.25 g/mol |
| Exact Mass | 516.01 |
| IUPAC Name | methyl 4,5,5,5-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-3,3-dimethoxy-4-(trifluoromethyl)pentanoate |
| SMILES | COC(=O)C(SC(F)(C(F)(F)F)C(F)(F)F)C(OC)(OC)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10F14O4S/c1-28-5(27)4(31-8(14,11(21,22)23)12(24,25)26)6(29-2,30-3)7(13,9(15,16)17)10(18,19)20/h4H,1-3H3 |
| InChIKey | RTTVYYADIULARS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.25 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|