C10H4F14O3S — CID 12642883
methyl 4,5,5,5-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-3-oxo-4-(trifluoromethyl)pentanoate (PubChem CID 12642883) has the molecular formula C10H4F14O3S and a molecular weight of 470.18 g/mol. Its IUPAC name is methyl 4,5,5,5-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-3-oxo-4-(trifluoromethyl)pentanoate.
| Compound Name | methyl 4,5,5,5-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-3-oxo-4-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 12642883 |
| Molecular Formula | C10H4F14O3S |
| Molecular Weight | 470.18 g/mol |
| Exact Mass | 469.97 |
| IUPAC Name | methyl 4,5,5,5-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-ylsulfanyl)-3-oxo-4-(trifluoromethyl)pentanoate |
| SMILES | COC(=O)C(SC(F)(C(F)(F)F)C(F)(F)F)C(=O)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F14O3S/c1-27-4(26)2(28-6(12,9(19,20)21)10(22,23)24)3(25)5(11,7(13,14)15)8(16,17)18/h2H,1H3 |
| InChIKey | FBAKDWQNBJDXCM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.18 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|