C14H16N6O2 — CID 126430967
(3R)-1-oxo-N-[3-(2H-tetrazol-5-yl)propyl]-3,4-dihydro-2H-isoquinoline-3-carboxamide (PubChem CID 126430967) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is (3R)-1-oxo-N-[3-(2H-tetrazol-5-yl)propyl]-3,4-dihydro-2H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-1-oxo-N-[3-(2H-tetrazol-5-yl)propyl]-3,4-dihydro-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 126430967 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (3R)-1-oxo-N-[3-(2H-tetrazol-5-yl)propyl]-3,4-dihydro-2H-isoquinoline-3-carboxamide |
| SMILES | O=C1N[C@@H](C(=O)NCCCc2nn[nH]n2)Cc2ccccc21 |
| InChI | InChI=1S/C14H16N6O2/c21-13-10-5-2-1-4-9(10)8-11(16-13)14(22)15-7-3-6-12-17-19-20-18-12/h1-2,4-5,11H,3,6-8H2,(H,15,22)(H,16,21)(H,17,18,19,20)/t11-/m1/s1 |
| InChIKey | VCGHZGZUJFSGLP-LLVKDONJSA-N |
| XLogP | -0.40 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|