C21H27N5O — CID 126433574
(3R)-3-(imidazol-1-ylmethyl)-N-(3-indol-1-ylpropyl)piperidine-1-carboxamide (PubChem CID 126433574) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is (3R)-3-(imidazol-1-ylmethyl)-N-(3-indol-1-ylpropyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-(imidazol-1-ylmethyl)-N-(3-indol-1-ylpropyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126433574 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (3R)-3-(imidazol-1-ylmethyl)-N-(3-indol-1-ylpropyl)piperidine-1-carboxamide |
| SMILES | O=C(NCCCn1ccc2ccccc21)N1CCC[C@H](Cn2ccnc2)C1 |
| InChI | InChI=1S/C21H27N5O/c27-21(26-11-3-5-18(16-26)15-24-14-10-22-17-24)23-9-4-12-25-13-8-19-6-1-2-7-20(19)25/h1-2,6-8,10,13-14,17-18H,3-5,9,11-12,15-16H2,(H,23,27)/t18-/m1/s1 |
| InChIKey | HCYLTKSDXWTADJ-GOSISDBHSA-N |
| XLogP | 3.35 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|