C17H24N4O3S — CID 132761951
N-(3-indol-1-ylpropyl)-4-methylsulfonylpiperazine-1-carboxamide (PubChem CID 132761951) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(3-indol-1-ylpropyl)-4-methylsulfonylpiperazine-1-carboxamide.
| Compound Name | N-(3-indol-1-ylpropyl)-4-methylsulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 132761951 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-(3-indol-1-ylpropyl)-4-methylsulfonylpiperazine-1-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)NCCCn2ccc3ccccc32)CC1 |
| InChI | InChI=1S/C17H24N4O3S/c1-25(23,24)21-13-11-20(12-14-21)17(22)18-8-4-9-19-10-7-15-5-2-3-6-16(15)19/h2-3,5-7,10H,4,8-9,11-14H2,1H3,(H,18,22) |
| InChIKey | JECSWNOEXLVJDR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|