C20H29N5O2 — CID 126433835
N-[2-[[(9S)-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl]carbamoylamino]ethyl]acetamide (PubChem CID 126433835) has the molecular formula C20H29N5O2 and a molecular weight of 371.49 g/mol. Its IUPAC name is N-[2-[[(9S)-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl]carbamoylamino]ethyl]acetamide.
| Compound Name | N-[2-[[(9S)-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl]carbamoylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 126433835 |
| Molecular Formula | C20H29N5O2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | N-[2-[[(9S)-1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl]carbamoylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNC(=O)N[C@H]1C2CN3CCN(C2)CC1(c1ccccc1)C3 |
| InChI | InChI=1S/C20H29N5O2/c1-15(26)21-7-8-22-19(27)23-18-16-11-24-9-10-25(12-16)14-20(18,13-24)17-5-3-2-4-6-17/h2-6,16,18H,7-14H2,1H3,(H,21,26)(H2,22,23,27)/t16?,18-,20?/m0/s1 |
| InChIKey | RISFDWCIYUGNQE-IPCDKGFNSA-N |
| XLogP | -0.01 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|