C23H27N3O2 — CID 131946938
2-phenoxy-N-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide (PubChem CID 131946938) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-phenoxy-N-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide.
| Compound Name | 2-phenoxy-N-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide |
|---|---|
| PubChem CID | 131946938 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-phenoxy-N-(1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-yl)acetamide |
| SMILES | O=C(COc1ccccc1)NC1C2CN3CCN(C2)CC1(c1ccccc1)C3 |
| InChI | InChI=1S/C23H27N3O2/c27-21(15-28-20-9-5-2-6-10-20)24-22-18-13-25-11-12-26(14-18)17-23(22,16-25)19-7-3-1-4-8-19/h1-10,18,22H,11-17H2,(H,24,27) |
| InChIKey | FRQFTYFCSFJDEJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |