C14H20N4O2S — CID 126433948
1-(2-imidazol-1-ylethyl)-3-[(2S)-2-methoxy-2-thiophen-2-ylethyl]-1-methylurea (PubChem CID 126433948) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylethyl)-3-[(2S)-2-methoxy-2-thiophen-2-ylethyl]-1-methylurea.
| Compound Name | 1-(2-imidazol-1-ylethyl)-3-[(2S)-2-methoxy-2-thiophen-2-ylethyl]-1-methylurea |
|---|---|
| PubChem CID | 126433948 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-(2-imidazol-1-ylethyl)-3-[(2S)-2-methoxy-2-thiophen-2-ylethyl]-1-methylurea |
| SMILES | CO[C@@H](CNC(=O)N(C)CCn1ccnc1)c1cccs1 |
| InChI | InChI=1S/C14H20N4O2S/c1-17(7-8-18-6-5-15-11-18)14(19)16-10-12(20-2)13-4-3-9-21-13/h3-6,9,11-12H,7-8,10H2,1-2H3,(H,16,19)/t12-/m0/s1 |
| InChIKey | VTGDVXUTTSZIDW-LBPRGKRZSA-N |
| XLogP | 1.97 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |