1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid

C13H9N3O2 — CID 12643401

IUPAC1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid
SMILESO=C(O)c1cnc2cnn(-c3ccccc3)c2c1
InChIInChI=1S/C13H9N3O2/c17-13(18)9-6-12-11(14-7-9)8-15-16(12)10-4-2-1-3-5-10/h1-8H,(H,17,18)
InChIKeyFHXIGNMYZJWPNS-UHFFFAOYSA-N
MW239.23 g/mol
LogP2.12
Rot. Bonds2

About 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid

1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid (PubChem CID 12643401) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid.

Molecular Properties

Compound Name1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid
PubChem CID12643401
Molecular FormulaC13H9N3O2
Molecular Weight239.23 g/mol
Exact Mass239.07
IUPAC Name1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid
SMILESO=C(O)c1cnc2cnn(-c3ccccc3)c2c1
InChIInChI=1S/C13H9N3O2/c17-13(18)9-6-12-11(14-7-9)8-15-16(12)10-4-2-1-3-5-10/h1-8H,(H,17,18)
InChIKeyFHXIGNMYZJWPNS-UHFFFAOYSA-N
XLogP2.12
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.23
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid?
The IUPAC name of 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid (CID 12643401) is 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid.
What is the SMILES notation for 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid?
The canonical SMILES for 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid is O=C(O)c1cnc2cnn(-c3ccccc3)c2c1.
What is the InChIKey of 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid?
The InChIKey is FHXIGNMYZJWPNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O2/c17-13(18)9-6-12-11(14-7-9)8-15-16(12)10-4-2-1-3-5-10/h1-8H,(H,17,18).
What are the key properties of 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid?
1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid has a molecular weight of 239.23 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyrazolo[4,5-b]pyridine-6-carboxylic acid is sourced from PubChem (CID 12643401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).