C21H19FN4O3 — CID 126434484
N-[[(2R)-5-fluoro-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-4,5,6,7-tetrahydro-2,1-benzoxazole-3-carboxamide (PubChem CID 126434484) has the molecular formula C21H19FN4O3 and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[[(2R)-5-fluoro-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-4,5,6,7-tetrahydro-2,1-benzoxazole-3-carboxamide.
| Compound Name | N-[[(2R)-5-fluoro-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-4,5,6,7-tetrahydro-2,1-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 126434484 |
| Molecular Formula | C21H19FN4O3 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[[(2R)-5-fluoro-7-pyrimidin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-4,5,6,7-tetrahydro-2,1-benzoxazole-3-carboxamide |
| SMILES | O=C(NC[C@H]1Cc2cc(F)cc(-c3ncccn3)c2O1)c1onc2c1CCCC2 |
| InChI | InChI=1S/C21H19FN4O3/c22-13-8-12-9-14(28-18(12)16(10-13)20-23-6-3-7-24-20)11-25-21(27)19-15-4-1-2-5-17(15)26-29-19/h3,6-8,10,14H,1-2,4-5,9,11H2,(H,25,27)/t14-/m1/s1 |
| InChIKey | CXAZJEFCGYQPOI-CQSZACIVSA-N |
| XLogP | 2.88 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |