C19H28N6O — CID 126437249
1-[4-(imidazol-1-ylmethyl)piperidin-1-yl]-2-[3-[(3R)-piperidin-3-yl]pyrazol-1-yl]ethanone (PubChem CID 126437249) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-[4-(imidazol-1-ylmethyl)piperidin-1-yl]-2-[3-[(3R)-piperidin-3-yl]pyrazol-1-yl]ethanone.
| Compound Name | 1-[4-(imidazol-1-ylmethyl)piperidin-1-yl]-2-[3-[(3R)-piperidin-3-yl]pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 126437249 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-[4-(imidazol-1-ylmethyl)piperidin-1-yl]-2-[3-[(3R)-piperidin-3-yl]pyrazol-1-yl]ethanone |
| SMILES | O=C(Cn1ccc([C@@H]2CCCNC2)n1)N1CCC(Cn2ccnc2)CC1 |
| InChI | InChI=1S/C19H28N6O/c26-19(14-25-10-5-18(22-25)17-2-1-6-20-12-17)24-8-3-16(4-9-24)13-23-11-7-21-15-23/h5,7,10-11,15-17,20H,1-4,6,8-9,12-14H2/t17-/m1/s1 |
| InChIKey | QUUYHMLQWBPNLF-QGZVFWFLSA-N |
| XLogP | 1.49 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |