C13H19N7O3 — CID 154908443
formic acid;1-[4-(imidazol-1-ylmethyl)piperidin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 154908443) has the molecular formula C13H19N7O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is formic acid;1-[4-(imidazol-1-ylmethyl)piperidin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | formic acid;1-[4-(imidazol-1-ylmethyl)piperidin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 154908443 |
| Molecular Formula | C13H19N7O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | formic acid;1-[4-(imidazol-1-ylmethyl)piperidin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnnn1)N1CCC(Cn2ccnc2)CC1.O=CO |
| InChI | InChI=1S/C12H17N7O.CH2O2/c20-12(8-19-10-14-15-16-19)18-4-1-11(2-5-18)7-17-6-3-13-9-17;2-1-3/h3,6,9-11H,1-2,4-5,7-8H2;1H,(H,2,3) |
| InChIKey | HVBNACGBCRFQLI-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|