C15H19N5OS2 — CID 126437423
(2S)-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-1-thiomorpholin-4-ylpropan-1-one (PubChem CID 126437423) has the molecular formula C15H19N5OS2 and a molecular weight of 349.49 g/mol. Its IUPAC name is (2S)-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-1-thiomorpholin-4-ylpropan-1-one.
| Compound Name | (2S)-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-1-thiomorpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 126437423 |
| Molecular Formula | C15H19N5OS2 |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (2S)-2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-1-thiomorpholin-4-ylpropan-1-one |
| SMILES | Cc1cccc(-n2nnnc2S[C@@H](C)C(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C15H19N5OS2/c1-11-4-3-5-13(10-11)20-15(16-17-18-20)23-12(2)14(21)19-6-8-22-9-7-19/h3-5,10,12H,6-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | RCVHVYNRZNDUBJ-LBPRGKRZSA-N |
| XLogP | 2.03 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |