C15H19N5OS — CID 17440342
2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 17440342) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 17440342 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[1-(3-methylphenyl)tetrazol-5-yl]sulfanyl-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | Cc1cccc(-n2nnnc2SC(C)C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C15H19N5OS/c1-11-6-5-7-13(10-11)20-15(16-17-18-20)22-12(2)14(21)19-8-3-4-9-19/h5-7,10,12H,3-4,8-9H2,1-2H3 |
| InChIKey | DLPABWZPINBZRV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |