C20H19FN2O — CID 126437659
(3R)-1-[4-(2-fluoro-5-methylphenyl)benzoyl]piperidine-3-carbonitrile (PubChem CID 126437659) has the molecular formula C20H19FN2O and a molecular weight of 322.38 g/mol. Its IUPAC name is (3R)-1-[4-(2-fluoro-5-methylphenyl)benzoyl]piperidine-3-carbonitrile.
| Compound Name | (3R)-1-[4-(2-fluoro-5-methylphenyl)benzoyl]piperidine-3-carbonitrile |
|---|---|
| PubChem CID | 126437659 |
| Molecular Formula | C20H19FN2O |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (3R)-1-[4-(2-fluoro-5-methylphenyl)benzoyl]piperidine-3-carbonitrile |
| SMILES | Cc1ccc(F)c(-c2ccc(C(=O)N3CCC[C@@H](C#N)C3)cc2)c1 |
| InChI | InChI=1S/C20H19FN2O/c1-14-4-9-19(21)18(11-14)16-5-7-17(8-6-16)20(24)23-10-2-3-15(12-22)13-23/h4-9,11,15H,2-3,10,13H2,1H3/t15-/m0/s1 |
| InChIKey | BUBCPSIHKOMVCK-HNNXBMFYSA-N |
| XLogP | 4.18 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |