C20H27N5O2 — CID 126438198
3-(5-aminopyrazin-2-yl)-N-[2-(dimethylamino)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 126438198) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-(5-aminopyrazin-2-yl)-N-[2-(dimethylamino)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 3-(5-aminopyrazin-2-yl)-N-[2-(dimethylamino)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126438198 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 3-(5-aminopyrazin-2-yl)-N-[2-(dimethylamino)ethyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | CN(C)CCN(C[C@H]1CCCO1)C(=O)c1cccc(-c2cnc(N)cn2)c1 |
| InChI | InChI=1S/C20H27N5O2/c1-24(2)8-9-25(14-17-7-4-10-27-17)20(26)16-6-3-5-15(11-16)18-12-23-19(21)13-22-18/h3,5-6,11-13,17H,4,7-10,14H2,1-2H3,(H2,21,23)/t17-/m1/s1 |
| InChIKey | ZTPAKVFGEDILII-QGZVFWFLSA-N |
| XLogP | 1.91 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |