C23H25N3O2 — CID 122565335
3-(3-aminoisoquinolin-6-yl)-N-ethyl-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 122565335) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-(3-aminoisoquinolin-6-yl)-N-ethyl-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-(3-aminoisoquinolin-6-yl)-N-ethyl-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 122565335 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 3-(3-aminoisoquinolin-6-yl)-N-ethyl-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCN(CC1CCCO1)C(=O)c1cccc(-c2ccc3cnc(N)cc3c2)c1 |
| InChI | InChI=1S/C23H25N3O2/c1-2-26(15-21-7-4-10-28-21)23(27)18-6-3-5-16(11-18)17-8-9-19-14-25-22(24)13-20(19)12-17/h3,5-6,8-9,11-14,21H,2,4,7,10,15H2,1H3,(H2,24,25) |
| InChIKey | HNYQDKWAIFJIDL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |