C19H24N4O2S — CID 119060180
4-(6-amino-2-methylsulfanylpyrimidin-4-yl)-N-ethyl-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 119060180) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 4-(6-amino-2-methylsulfanylpyrimidin-4-yl)-N-ethyl-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-(6-amino-2-methylsulfanylpyrimidin-4-yl)-N-ethyl-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 119060180 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 4-(6-amino-2-methylsulfanylpyrimidin-4-yl)-N-ethyl-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCN(CC1CCCO1)C(=O)c1ccc(-c2cc(N)nc(SC)n2)cc1 |
| InChI | InChI=1S/C19H24N4O2S/c1-3-23(12-15-5-4-10-25-15)18(24)14-8-6-13(7-9-14)16-11-17(20)22-19(21-16)26-2/h6-9,11,15H,3-5,10,12H2,1-2H3,(H2,20,21,22) |
| InChIKey | CRHMTDREKOGQBY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |