C16H22N4O3 — CID 126439923
1-ethyl-1-[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-3-[2-(1H-imidazol-5-yl)ethyl]urea (PubChem CID 126439923) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-ethyl-1-[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-3-[2-(1H-imidazol-5-yl)ethyl]urea.
| Compound Name | 1-ethyl-1-[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-3-[2-(1H-imidazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 126439923 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 1-ethyl-1-[(2R)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-3-[2-(1H-imidazol-5-yl)ethyl]urea |
| SMILES | CCN(C[C@H](O)c1cccc(O)c1)C(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C16H22N4O3/c1-2-20(10-15(22)12-4-3-5-14(21)8-12)16(23)18-7-6-13-9-17-11-19-13/h3-5,8-9,11,15,21-22H,2,6-7,10H2,1H3,(H,17,19)(H,18,23)/t15-/m0/s1 |
| InChIKey | MQEDRPJSPUPORC-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |