C19H25FN4O — CID 126439991
3-[(1S)-1-(4-fluorophenyl)ethyl]-1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methylurea (PubChem CID 126439991) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is 3-[(1S)-1-(4-fluorophenyl)ethyl]-1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methylurea.
| Compound Name | 3-[(1S)-1-(4-fluorophenyl)ethyl]-1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 126439991 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-[(1S)-1-(4-fluorophenyl)ethyl]-1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methylurea |
| SMILES | C[C@H](NC(=O)N(C)Cc1n[nH]c2c1CCCCC2)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN4O/c1-13(14-8-10-15(20)11-9-14)21-19(25)24(2)12-18-16-6-4-3-5-7-17(16)22-23-18/h8-11,13H,3-7,12H2,1-2H3,(H,21,25)(H,22,23)/t13-/m0/s1 |
| InChIKey | HLKQWZWBTNMCSJ-ZDUSSCGKSA-N |
| XLogP | 3.72 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |