C20H29N7O — CID 131906751
1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methyl-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea (PubChem CID 131906751) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methyl-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea.
| Compound Name | 1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methyl-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
|---|---|
| PubChem CID | 131906751 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-1-methyl-3-(1-pyrimidin-2-ylpiperidin-3-yl)urea |
| SMILES | CN(Cc1n[nH]c2c1CCCCC2)C(=O)NC1CCCN(c2ncccn2)C1 |
| InChI | InChI=1S/C20H29N7O/c1-26(14-18-16-8-3-2-4-9-17(16)24-25-18)20(28)23-15-7-5-12-27(13-15)19-21-10-6-11-22-19/h6,10-11,15H,2-5,7-9,12-14H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | CFVILXXUZHAVMD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |