C19H33N5O — CID 121497078
3-[3-[cyclopentyl(methyl)amino]propyl]-1-methyl-1-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)urea (PubChem CID 121497078) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is 3-[3-[cyclopentyl(methyl)amino]propyl]-1-methyl-1-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)urea.
| Compound Name | 3-[3-[cyclopentyl(methyl)amino]propyl]-1-methyl-1-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 121497078 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | 3-[3-[cyclopentyl(methyl)amino]propyl]-1-methyl-1-(4,5,6,7-tetrahydro-1H-indazol-3-ylmethyl)urea |
| SMILES | CN(Cc1n[nH]c2c1CCCC2)C(=O)NCCCN(C)C1CCCC1 |
| InChI | InChI=1S/C19H33N5O/c1-23(15-8-3-4-9-15)13-7-12-20-19(25)24(2)14-18-16-10-5-6-11-17(16)21-22-18/h15H,3-14H2,1-2H3,(H,20,25)(H,21,22) |
| InChIKey | WTKNENOBQNGBFW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|