C15H21FN2O3 — CID 126441973
3-(2-fluorophenoxy)-N-[(2R)-1-methoxybutan-2-yl]azetidine-1-carboxamide (PubChem CID 126441973) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is 3-(2-fluorophenoxy)-N-[(2R)-1-methoxybutan-2-yl]azetidine-1-carboxamide.
| Compound Name | 3-(2-fluorophenoxy)-N-[(2R)-1-methoxybutan-2-yl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 126441973 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 3-(2-fluorophenoxy)-N-[(2R)-1-methoxybutan-2-yl]azetidine-1-carboxamide |
| SMILES | CC[C@H](COC)NC(=O)N1CC(Oc2ccccc2F)C1 |
| InChI | InChI=1S/C15H21FN2O3/c1-3-11(10-20-2)17-15(19)18-8-12(9-18)21-14-7-5-4-6-13(14)16/h4-7,11-12H,3,8-10H2,1-2H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | ZRISITKJZUYGEI-LLVKDONJSA-N |
| XLogP | 2.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |