About N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide
N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide (PubChem CID 126442996) has the molecular formula C21H25N3O
and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide |
| PubChem CID | 126442996 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide |
| SMILES | CC1(C)C[C@]1(CNC(=O)N1CC(c2ccncc2)C1)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O/c1-20(2)14-21(20,18-6-4-3-5-7-18)15-23-19(25)24-12-17(13-24)16-8-10-22-11-9-16/h3-11,17H,12-15H2,1-2H3,(H,23,25)/t21-/m0/s1 |
| InChIKey | GDOUAFSDGDTOKJ-NRFANRHFSA-N |
| XLogP | 3.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide?
The IUPAC name of N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide (CID 126442996) is N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide.
What is the SMILES notation for N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide?
The canonical SMILES for N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide is CC1(C)C[C@]1(CNC(=O)N1CC(c2ccncc2)C1)c1ccccc1.
What is the InChIKey of N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide?
The InChIKey is GDOUAFSDGDTOKJ-NRFANRHFSA-N. The full InChI is InChI=1S/C21H25N3O/c1-20(2)14-21(20,18-6-4-3-5-7-18)15-23-19(25)24-12-17(13-24)16-8-10-22-11-9-16/h3-11,17H,12-15H2,1-2H3,(H,23,25)/t21-/m0/s1.
What are the key properties of N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide?
N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide has a molecular weight of 335.45 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R)-2,2-dimethyl-1-phenylcyclopropyl]methyl]-3-pyridin-4-ylazetidine-1-carboxamide is sourced from PubChem (CID 126442996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).