C16H14F2N2O — CID 56911803
2-(2,3-difluorophenyl)-1-(3-pyridin-4-ylazetidin-1-yl)ethanone (PubChem CID 56911803) has the molecular formula C16H14F2N2O and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-1-(3-pyridin-4-ylazetidin-1-yl)ethanone.
| Compound Name | 2-(2,3-difluorophenyl)-1-(3-pyridin-4-ylazetidin-1-yl)ethanone |
|---|---|
| PubChem CID | 56911803 |
| Molecular Formula | C16H14F2N2O |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-(2,3-difluorophenyl)-1-(3-pyridin-4-ylazetidin-1-yl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1F)N1CC(c2ccncc2)C1 |
| InChI | InChI=1S/C16H14F2N2O/c17-14-3-1-2-12(16(14)18)8-15(21)20-9-13(10-20)11-4-6-19-7-5-11/h1-7,13H,8-10H2 |
| InChIKey | DNCXBPDKADCPPG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |