C17H19F2NO — CID 91786878
1-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-(2,3-difluorophenyl)ethanone (PubChem CID 91786878) has the molecular formula C17H19F2NO and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-(2,3-difluorophenyl)ethanone.
| Compound Name | 1-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-(2,3-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 91786878 |
| Molecular Formula | C17H19F2NO |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[(3aR,7aS)-5-methyl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-2-(2,3-difluorophenyl)ethanone |
| SMILES | CC1=CC[C@@H]2CN(C(=O)Cc3cccc(F)c3F)C[C@@H]2C1 |
| InChI | InChI=1S/C17H19F2NO/c1-11-5-6-13-9-20(10-14(13)7-11)16(21)8-12-3-2-4-15(18)17(12)19/h2-5,13-14H,6-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | GFAGKDWICQXBSK-KGLIPLIRSA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|